C12H26N4O — CID 102347460
(2S,3R)-2-azido-1-(dipropylamino)hexan-3-ol (PubChem CID 102347460) has the molecular formula C12H26N4O and a molecular weight of 242.37 g/mol. Its IUPAC name is (2S,3R)-2-azido-1-(dipropylamino)hexan-3-ol.
| Compound Name | (2S,3R)-2-azido-1-(dipropylamino)hexan-3-ol |
|---|---|
| PubChem CID | 102347460 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (2S,3R)-2-azido-1-(dipropylamino)hexan-3-ol |
| SMILES | CCC[C@@H](O)[C@H](CN(CCC)CCC)N=[N+]=[N-] |
| InChI | InChI=1S/C12H26N4O/c1-4-7-12(17)11(14-15-13)10-16(8-5-2)9-6-3/h11-12,17H,4-10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | YUJWMCLIMUDRLS-NWDGAFQWSA-N |
| XLogP | 2.95 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|