C11H19IOS2 — CID 102352129
(Z)-1-(1,3-dithian-2-yl)-5-iodohept-5-en-3-ol (PubChem CID 102352129) has the molecular formula C11H19IOS2 and a molecular weight of 358.31 g/mol. Its IUPAC name is (Z)-1-(1,3-dithian-2-yl)-5-iodohept-5-en-3-ol.
| Compound Name | (Z)-1-(1,3-dithian-2-yl)-5-iodohept-5-en-3-ol |
|---|---|
| PubChem CID | 102352129 |
| Molecular Formula | C11H19IOS2 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | (Z)-1-(1,3-dithian-2-yl)-5-iodohept-5-en-3-ol |
| SMILES | C/C=C(\I)CC(O)CCC1SCCCS1 |
| InChI | InChI=1S/C11H19IOS2/c1-2-9(12)8-10(13)4-5-11-14-6-3-7-15-11/h2,10-11,13H,3-8H2,1H3/b9-2- |
| InChIKey | NHXLLTNBKFOAJM-MBXJOHMKSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|