C4H4ClN2O- — CID 102355706
3-chloro-1,6-dihydropyridazin-6-olate (PubChem CID 102355706) has the molecular formula C4H4ClN2O- and a molecular weight of 131.54 g/mol. Its IUPAC name is 3-chloro-1,6-dihydropyridazin-6-olate.
| Compound Name | 3-chloro-1,6-dihydropyridazin-6-olate |
|---|---|
| PubChem CID | 102355706 |
| Molecular Formula | C4H4ClN2O- |
| Molecular Weight | 131.54 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | 3-chloro-1,6-dihydropyridazin-6-olate |
| SMILES | [O-]C1C=CC(Cl)=NN1 |
| InChI | InChI=1S/C4H4ClN2O/c5-3-1-2-4(8)7-6-3/h1-2,4,7H/q-1 |
| InChIKey | WQMYMKIFWGXVAQ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 47.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.54 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |