benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate

C24H23NO3 — CID 102356557

IUPACbenzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate
SMILESC=Cc1c(OC)cccc1N(Cc1ccccc1)C(=O)OCc1ccccc1
InChIInChI=1S/C24H23NO3/c1-3-21-22(15-10-16-23(21)27-2)25(17-19-11-6-4-7-12-19)24(26)28-18-20-13-8-5-9-14-20/h3-16H,1,17-18H2,2H3
InChIKeyRDGPLBKYVHELAW-UHFFFAOYSA-N
MW373.45 g/mol
LogP5.68
Rot. Bonds7

About benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate

benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate (PubChem CID 102356557) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate.

Molecular Properties

Compound Namebenzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate
PubChem CID102356557
Molecular FormulaC24H23NO3
Molecular Weight373.45 g/mol
Exact Mass373.17
IUPAC Namebenzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate
SMILESC=Cc1c(OC)cccc1N(Cc1ccccc1)C(=O)OCc1ccccc1
InChIInChI=1S/C24H23NO3/c1-3-21-22(15-10-16-23(21)27-2)25(17-19-11-6-4-7-12-19)24(26)28-18-20-13-8-5-9-14-20/h3-16H,1,17-18H2,2H3
InChIKeyRDGPLBKYVHELAW-UHFFFAOYSA-N
XLogP5.68
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms28
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500373.45
LogP ≤ 55.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate?
The IUPAC name of benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate (CID 102356557) is benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate.
What is the SMILES notation for benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate?
The canonical SMILES for benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate is C=Cc1c(OC)cccc1N(Cc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate?
The InChIKey is RDGPLBKYVHELAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3/c1-3-21-22(15-10-16-23(21)27-2)25(17-19-11-6-4-7-12-19)24(26)28-18-20-13-8-5-9-14-20/h3-16H,1,17-18H2,2H3.
What are the key properties of benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate?
benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate has a molecular weight of 373.45 g/mol, XLogP of 5.68, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-benzyl-N-(2-ethenyl-3-methoxyphenyl)carbamate is sourced from PubChem (CID 102356557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).