C26H26N2O5 — CID 71305163
prop-2-enyl N-benzyl-N-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]carbamate (PubChem CID 71305163) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is prop-2-enyl N-benzyl-N-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | prop-2-enyl N-benzyl-N-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 71305163 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | prop-2-enyl N-benzyl-N-[2-[(2,5-dimethoxyphenyl)carbamoyl]phenyl]carbamate |
| SMILES | C=CCOC(=O)N(Cc1ccccc1)c1ccccc1C(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C26H26N2O5/c1-4-16-33-26(30)28(18-19-10-6-5-7-11-19)23-13-9-8-12-21(23)25(29)27-22-17-20(31-2)14-15-24(22)32-3/h4-15,17H,1,16,18H2,2-3H3,(H,27,29) |
| InChIKey | DCKDSCVXCQHPRR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|