C19H23NO5 — CID 102358937
dimethyl (2S,3S,6R,8S)-6-hydroxy-3-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate (PubChem CID 102358937) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is dimethyl (2S,3S,6R,8S)-6-hydroxy-3-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate.
| Compound Name | dimethyl (2S,3S,6R,8S)-6-hydroxy-3-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 102358937 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | dimethyl (2S,3S,6R,8S)-6-hydroxy-3-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(C(=O)OC)C[C@@H](O)CN2[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H23NO5/c1-24-17(22)15-11-19(18(23)25-2)10-14(21)12-20(19)16(15)9-8-13-6-4-3-5-7-13/h3-9,14-16,21H,10-12H2,1-2H3/b9-8+/t14-,15+,16+,19-/m1/s1 |
| InChIKey | ZUAQMYQQMRFFGY-KWXHPWAWSA-N |
| XLogP | 1.24 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |