C35H43NO6 — CID 134946967
2-O,6-O-ditert-butyl 8-O-methyl (2R,3R,5R,6R)-3,5-bis[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate (PubChem CID 134946967) has the molecular formula C35H43NO6 and a molecular weight of 573.73 g/mol. Its IUPAC name is 2-O,6-O-ditert-butyl 8-O-methyl (2R,3R,5R,6R)-3,5-bis[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate.
| Compound Name | 2-O,6-O-ditert-butyl 8-O-methyl (2R,3R,5R,6R)-3,5-bis[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate |
|---|---|
| PubChem CID | 134946967 |
| Molecular Formula | C35H43NO6 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 2-O,6-O-ditert-butyl 8-O-methyl (2R,3R,5R,6R)-3,5-bis[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate |
| SMILES | COC(=O)C12C[C@@H](C(=O)OC(C)(C)C)[C@@H](/C=C/c3ccccc3)N1[C@H](/C=C/c1ccccc1)[C@H](C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C35H43NO6/c1-33(2,3)41-30(37)26-22-35(32(39)40-7)23-27(31(38)42-34(4,5)6)29(21-19-25-16-12-9-13-17-25)36(35)28(26)20-18-24-14-10-8-11-15-24/h8-21,26-29H,22-23H2,1-7H3/b20-18+,21-19+/t26-,27-,28-,29-/m1/s1 |
| InChIKey | UAFHSTNAHWSKON-VQEKVIAESA-N |
| XLogP | 6.09 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|