C18H27NO12S — CID 102366223
methyl 3-hydroxy-2-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylamino]propanoate (PubChem CID 102366223) has the molecular formula C18H27NO12S and a molecular weight of 481.48 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylamino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylamino]propanoate |
|---|---|
| PubChem CID | 102366223 |
| Molecular Formula | C18H27NO12S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | methyl 3-hydroxy-2-[[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylamino]propanoate |
| SMILES | COC(=O)C(CO)NS[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H27NO12S/c1-8(21)27-7-13-14(28-9(2)22)15(29-10(3)23)16(30-11(4)24)18(31-13)32-19-12(6-20)17(25)26-5/h12-16,18-20H,6-7H2,1-5H3/t12?,13-,14-,15+,16-,18+/m1/s1 |
| InChIKey | BYMNXCLNMAPNLU-SVYMGOSOSA-N |
| XLogP | -1.16 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|