C17H24INO2 — CID 102367501
(3S,5S)-5-butyl-3-(iodomethyl)-1-(4-methoxyphenyl)-3-methylpyrrolidin-2-one (PubChem CID 102367501) has the molecular formula C17H24INO2 and a molecular weight of 401.29 g/mol. Its IUPAC name is (3S,5S)-5-butyl-3-(iodomethyl)-1-(4-methoxyphenyl)-3-methylpyrrolidin-2-one.
| Compound Name | (3S,5S)-5-butyl-3-(iodomethyl)-1-(4-methoxyphenyl)-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102367501 |
| Molecular Formula | C17H24INO2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (3S,5S)-5-butyl-3-(iodomethyl)-1-(4-methoxyphenyl)-3-methylpyrrolidin-2-one |
| SMILES | CCCC[C@H]1C[C@](C)(CI)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H24INO2/c1-4-5-6-14-11-17(2,12-18)16(20)19(14)13-7-9-15(21-3)10-8-13/h7-10,14H,4-6,11-12H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | LOQZWLOFWZBPQW-WMLDXEAASA-N |
| XLogP | 4.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|