C23H19N — CID 102369143
5-(3-methylphenyl)-2,3-diphenyl-1H-pyrrole (PubChem CID 102369143) has the molecular formula C23H19N and a molecular weight of 309.41 g/mol. Its IUPAC name is 5-(3-methylphenyl)-2,3-diphenyl-1H-pyrrole.
| Compound Name | 5-(3-methylphenyl)-2,3-diphenyl-1H-pyrrole |
|---|---|
| PubChem CID | 102369143 |
| Molecular Formula | C23H19N |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-(3-methylphenyl)-2,3-diphenyl-1H-pyrrole |
| SMILES | Cc1cccc(-c2cc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C23H19N/c1-17-9-8-14-20(15-17)22-16-21(18-10-4-2-5-11-18)23(24-22)19-12-6-3-7-13-19/h2-16,24H,1H3 |
| InChIKey | OIDVCNBWSNQSLQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |