C23H21N3O5 — CID 102375695
N-[(3S,4S)-3-ethyl-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide (PubChem CID 102375695) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-[(3S,4S)-3-ethyl-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(3S,4S)-3-ethyl-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 102375695 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[(3S,4S)-3-ethyl-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide |
| SMILES | CC[C@H]1CCc2ccc3ccccc3c2[C@H]1NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21N3O5/c1-2-14-7-9-16-10-8-15-5-3-4-6-20(15)21(16)22(14)24-23(27)17-11-18(25(28)29)13-19(12-17)26(30)31/h3-6,8,10-14,22H,2,7,9H2,1H3,(H,24,27)/t14-,22-/m0/s1 |
| InChIKey | JPMCXPIGIYYOKM-FPTDNZKUSA-N |
| XLogP | 5.10 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|