C15H9NOS — CID 102382197
2-methylindeno[2,1-f][1,3]benzothiazol-9-one (PubChem CID 102382197) has the molecular formula C15H9NOS and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-methylindeno[2,1-f][1,3]benzothiazol-9-one.
| Compound Name | 2-methylindeno[2,1-f][1,3]benzothiazol-9-one |
|---|---|
| PubChem CID | 102382197 |
| Molecular Formula | C15H9NOS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-methylindeno[2,1-f][1,3]benzothiazol-9-one |
| SMILES | Cc1nc2cc3c(cc2s1)-c1ccccc1C3=O |
| InChI | InChI=1S/C15H9NOS/c1-8-16-13-6-12-11(7-14(13)18-8)9-4-2-3-5-10(9)15(12)17/h2-7H,1H3 |
| InChIKey | YEYLENLDJUHGQF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |