C9H14F3NO3S — CID 102385970
methyl (2S,3S)-3-methyl-5-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 102385970) has the molecular formula C9H14F3NO3S and a molecular weight of 273.28 g/mol. Its IUPAC name is methyl (2S,3S)-3-methyl-5-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | methyl (2S,3S)-3-methyl-5-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 102385970 |
| Molecular Formula | C9H14F3NO3S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | methyl (2S,3S)-3-methyl-5-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | COC(=O)[C@@H](NC(=O)C(F)(F)F)[C@@H](C)CCS |
| InChI | InChI=1S/C9H14F3NO3S/c1-5(3-4-17)6(7(14)16-2)13-8(15)9(10,11)12/h5-6,17H,3-4H2,1-2H3,(H,13,15)/t5-,6-/m0/s1 |
| InChIKey | MFCFRGOWGWRLNV-WDSKDSINSA-N |
| XLogP | 1.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|