C9H12N2O5 — CID 102394644
1,3-bis(methoxymethyl)-2,6-dioxopyrimidine-4-carbaldehyde (PubChem CID 102394644) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is 1,3-bis(methoxymethyl)-2,6-dioxopyrimidine-4-carbaldehyde.
| Compound Name | 1,3-bis(methoxymethyl)-2,6-dioxopyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 102394644 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1,3-bis(methoxymethyl)-2,6-dioxopyrimidine-4-carbaldehyde |
| SMILES | COCn1c(C=O)cc(=O)n(COC)c1=O |
| InChI | InChI=1S/C9H12N2O5/c1-15-5-10-7(4-12)3-8(13)11(6-16-2)9(10)14/h3-4H,5-6H2,1-2H3 |
| InChIKey | DMLIXRSSKCXCDC-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|