C23H40O5Si — CID 102399516
methyl (3R,3aR,7aR)-6-(1-acetyloxybutyl)-3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate (PubChem CID 102399516) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is methyl (3R,3aR,7aR)-6-(1-acetyloxybutyl)-3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate.
| Compound Name | methyl (3R,3aR,7aR)-6-(1-acetyloxybutyl)-3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 102399516 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | methyl (3R,3aR,7aR)-6-(1-acetyloxybutyl)-3-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate |
| SMILES | CCCC(OC(C)=O)C1=C[C@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C(=O)OC)CC1 |
| InChI | InChI=1S/C23H40O5Si/c1-9-10-19(27-16(2)24)17-13-14-23(21(25)26-6)18(15-17)11-12-20(23)28-29(7,8)22(3,4)5/h15,18-20H,9-14H2,1-8H3/t18-,19?,20-,23-/m1/s1 |
| InChIKey | LBJNKRWOBAUQFS-HCUTXMHJSA-N |
| XLogP | 5.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|