C16H19NO3 — CID 102400447
1-(1,3-benzodioxol-5-yl)-4-deuterio-2-pyrrol-1-ylpentan-2-ol (PubChem CID 102400447) has the molecular formula C16H19NO3 and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-deuterio-2-pyrrol-1-ylpentan-2-ol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-deuterio-2-pyrrol-1-ylpentan-2-ol |
|---|---|
| PubChem CID | 102400447 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-deuterio-2-pyrrol-1-ylpentan-2-ol |
| SMILES | [2H]C(C)CC(O)(Cc1ccc2c(c1)OCO2)n1cccc1 |
| InChI | InChI=1S/C16H19NO3/c1-2-7-16(18,17-8-3-4-9-17)11-13-5-6-14-15(10-13)20-12-19-14/h3-6,8-10,18H,2,7,11-12H2,1H3/i2D |
| InChIKey | DCVXVQKUPYDWFU-VMNATFBRSA-N |
| XLogP | 2.90 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |