C34H35N5O7 — CID 102403302
3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-2-nitroethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 102403302) has the molecular formula C34H35N5O7 and a molecular weight of 625.68 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-2-nitroethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-2-nitroethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 102403302 |
| Molecular Formula | C34H35N5O7 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-13-ethenyl-8-(1-hydroxy-2-nitroethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3C(O)C[N+](=O)[O-] |
| InChI | InChI=1S/C34H35N5O7/c1-6-20-16(2)25-13-30-34(31(40)15-39(45)46)19(5)26(38-30)11-23-17(3)21(7-9-32(41)42)28(36-23)14-29-22(8-10-33(43)44)18(4)24(37-29)12-27(20)35-25/h6,11-14,31,35,38,40H,1,7-10,15H2,2-5H3,(H,41,42)(H,43,44)/b23-11-,24-12-,25-13-,26-11-,27-12-,28-14-,29-14-,30-13- |
| InChIKey | UGYCREDJIHIQAZ-WNZVQXEASA-N |
| XLogP | 6.48 |
| TPSA | 195.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|