C20H20O3S — CID 102418381
(1R,2S,7R,8S)-2,4-dimethyl-5-(4-methylphenyl)sulfinyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 102418381) has the molecular formula C20H20O3S and a molecular weight of 340.44 g/mol. Its IUPAC name is (1R,2S,7R,8S)-2,4-dimethyl-5-(4-methylphenyl)sulfinyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1R,2S,7R,8S)-2,4-dimethyl-5-(4-methylphenyl)sulfinyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 102418381 |
| Molecular Formula | C20H20O3S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (1R,2S,7R,8S)-2,4-dimethyl-5-(4-methylphenyl)sulfinyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CC1=C(S(=O)c2ccc(C)cc2)C(=O)[C@@H]2[C@@H]3C=C[C@@H](C3)[C@]2(C)C1=O |
| InChI | InChI=1S/C20H20O3S/c1-11-4-8-15(9-5-11)24(23)18-12(2)19(22)20(3)14-7-6-13(10-14)16(20)17(18)21/h4-9,13-14,16H,10H2,1-3H3/t13-,14+,16+,20+,24?/m1/s1 |
| InChIKey | HDCFUDOYAXGBFR-FPXIAVFWSA-N |
| XLogP | 3.36 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|