C18H24O4 — CID 102424170
(1'R,3'R,8'R,9'Z,12'S,15'S)-9'-methylspiro[1,3-dioxolane-2,5'-16-oxatetracyclo[10.4.0.01,15.03,8]hexadec-9-ene]-2'-one (PubChem CID 102424170) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1'R,3'R,8'R,9'Z,12'S,15'S)-9'-methylspiro[1,3-dioxolane-2,5'-16-oxatetracyclo[10.4.0.01,15.03,8]hexadec-9-ene]-2'-one.
| Compound Name | (1'R,3'R,8'R,9'Z,12'S,15'S)-9'-methylspiro[1,3-dioxolane-2,5'-16-oxatetracyclo[10.4.0.01,15.03,8]hexadec-9-ene]-2'-one |
|---|---|
| PubChem CID | 102424170 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (1'R,3'R,8'R,9'Z,12'S,15'S)-9'-methylspiro[1,3-dioxolane-2,5'-16-oxatetracyclo[10.4.0.01,15.03,8]hexadec-9-ene]-2'-one |
| SMILES | C/C1=C/C[C@@H]2CC[C@@H]3O[C@]23C(=O)[C@@H]2CC3(CC[C@@H]12)OCCO3 |
| InChI | InChI=1S/C18H24O4/c1-11-2-3-12-4-5-15-18(12,22-15)16(19)14-10-17(7-6-13(11)14)20-8-9-21-17/h2,12-15H,3-10H2,1H3/b11-2-/t12-,13+,14-,15+,18-/m1/s1 |
| InChIKey | JVDGGGWZZLQTLK-OAFNYEKYSA-N |
| XLogP | 2.61 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|