C42H58O5 — CID 102426863
[4-[(3S,5R,7R,9R)-3,5,7,9-tetramethylundecanoyl]oxyphenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 102426863) has the molecular formula C42H58O5 and a molecular weight of 642.92 g/mol. Its IUPAC name is [4-[(3S,5R,7R,9R)-3,5,7,9-tetramethylundecanoyl]oxyphenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-[(3S,5R,7R,9R)-3,5,7,9-tetramethylundecanoyl]oxyphenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 102426863 |
| Molecular Formula | C42H58O5 |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.43 |
| IUPAC Name | [4-[(3S,5R,7R,9R)-3,5,7,9-tetramethylundecanoyl]oxyphenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(OC(=O)C[C@@H](C)C[C@H](C)C[C@H](C)C[C@H](C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H58O5/c1-7-9-10-11-12-13-26-45-38-20-18-36(19-21-38)35-14-16-37(17-15-35)42(44)47-40-24-22-39(23-25-40)46-41(43)30-34(6)29-33(5)28-32(4)27-31(3)8-2/h14-25,31-34H,7-13,26-30H2,1-6H3/t31-,32-,33-,34+/m1/s1 |
| InChIKey | PPABSTCUQFCLSG-PZMYXVABSA-N |
| XLogP | 11.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|