C19H10I2N2O3 — CID 102429861
2-amino-4-(1,3-dioxoinden-2-yl)-6,8-diiodo-4H-chromene-3-carbonitrile (PubChem CID 102429861) has the molecular formula C19H10I2N2O3 and a molecular weight of 568.11 g/mol. Its IUPAC name is 2-amino-4-(1,3-dioxoinden-2-yl)-6,8-diiodo-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(1,3-dioxoinden-2-yl)-6,8-diiodo-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 102429861 |
| Molecular Formula | C19H10I2N2O3 |
| Molecular Weight | 568.11 g/mol |
| Exact Mass | 567.88 |
| IUPAC Name | 2-amino-4-(1,3-dioxoinden-2-yl)-6,8-diiodo-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(I)cc(I)cc2C1C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H10I2N2O3/c20-8-5-11-14(12(7-22)19(23)26-18(11)13(21)6-8)15-16(24)9-3-1-2-4-10(9)17(15)25/h1-6,14-15H,23H2 |
| InChIKey | FKQYQMJEJZQYRM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|