C15H22O2 — CID 10243132
(5Z)-4-methoxy-4-methyl-5-oct-1-en-4-ylidenecyclopent-2-en-1-one (PubChem CID 10243132) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (5Z)-4-methoxy-4-methyl-5-oct-1-en-4-ylidenecyclopent-2-en-1-one.
| Compound Name | (5Z)-4-methoxy-4-methyl-5-oct-1-en-4-ylidenecyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10243132 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (5Z)-4-methoxy-4-methyl-5-oct-1-en-4-ylidenecyclopent-2-en-1-one |
| SMILES | C=CC/C(CCCC)=C1\C(=O)C=CC1(C)OC |
| InChI | InChI=1S/C15H22O2/c1-5-7-9-12(8-6-2)14-13(16)10-11-15(14,3)17-4/h6,10-11H,2,5,7-9H2,1,3-4H3/b14-12- |
| InChIKey | NKKLOWIQRNILID-OWBHPGMISA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|