C44H62FN2OP — CID 102440374
cyclohexyl-[(4S,5S)-4,5-dicyclohexyl-2-(1-dicyclohexylphosphanyl-8-fluoronaphthalen-2-yl)-4,5-dihydroimidazol-1-yl]methanone (PubChem CID 102440374) has the molecular formula C44H62FN2OP and a molecular weight of 684.97 g/mol. Its IUPAC name is cyclohexyl-[(4S,5S)-4,5-dicyclohexyl-2-(1-dicyclohexylphosphanyl-8-fluoronaphthalen-2-yl)-4,5-dihydroimidazol-1-yl]methanone.
| Compound Name | cyclohexyl-[(4S,5S)-4,5-dicyclohexyl-2-(1-dicyclohexylphosphanyl-8-fluoronaphthalen-2-yl)-4,5-dihydroimidazol-1-yl]methanone |
|---|---|
| PubChem CID | 102440374 |
| Molecular Formula | C44H62FN2OP |
| Molecular Weight | 684.97 g/mol |
| Exact Mass | 684.46 |
| IUPAC Name | cyclohexyl-[(4S,5S)-4,5-dicyclohexyl-2-(1-dicyclohexylphosphanyl-8-fluoronaphthalen-2-yl)-4,5-dihydroimidazol-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1C(c2ccc3cccc(F)c3c2P(C2CCCCC2)C2CCCCC2)=N[C@@H](C2CCCCC2)[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C44H62FN2OP/c45-38-28-16-23-31-29-30-37(42(39(31)38)49(35-24-12-4-13-25-35)36-26-14-5-15-27-36)43-46-40(32-17-6-1-7-18-32)41(33-19-8-2-9-20-33)47(43)44(48)34-21-10-3-11-22-34/h16,23,28-30,32-36,40-41H,1-15,17-22,24-27H2/t40-,41-/m0/s1 |
| InChIKey | YHSXXKWIVIFNRJ-YATWDLPUSA-N |
| XLogP | 11.82 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.97 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|