C22H22N2O — CID 102447591
(4aS,9aS)-3-phenyl-4a,9-bis(prop-2-enyl)-4,9a-dihydrooxazino[6,5-b]indole (PubChem CID 102447591) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is (4aS,9aS)-3-phenyl-4a,9-bis(prop-2-enyl)-4,9a-dihydrooxazino[6,5-b]indole.
| Compound Name | (4aS,9aS)-3-phenyl-4a,9-bis(prop-2-enyl)-4,9a-dihydrooxazino[6,5-b]indole |
|---|---|
| PubChem CID | 102447591 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (4aS,9aS)-3-phenyl-4a,9-bis(prop-2-enyl)-4,9a-dihydrooxazino[6,5-b]indole |
| SMILES | C=CCN1c2ccccc2[C@]2(CC=C)CC(c3ccccc3)=NO[C@H]12 |
| InChI | InChI=1S/C22H22N2O/c1-3-14-22-16-19(17-10-6-5-7-11-17)23-25-21(22)24(15-4-2)20-13-9-8-12-18(20)22/h3-13,21H,1-2,14-16H2/t21-,22-/m0/s1 |
| InChIKey | WTRIZMCKEQMSNF-VXKWHMMOSA-N |
| XLogP | 4.66 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|