C18H28O3Si — CID 10245479
(2S)-2-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-2-(hydroxymethyl)cyclobutan-1-one (PubChem CID 10245479) has the molecular formula C18H28O3Si and a molecular weight of 320.50 g/mol. Its IUPAC name is (2S)-2-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-2-(hydroxymethyl)cyclobutan-1-one.
| Compound Name | (2S)-2-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-2-(hydroxymethyl)cyclobutan-1-one |
|---|---|
| PubChem CID | 10245479 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2S)-2-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-2-(hydroxymethyl)cyclobutan-1-one |
| SMILES | Cc1ccc([C@]2(CO)CCC2=O)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28O3Si/c1-13-7-8-14(18(12-19)10-9-16(18)20)15(11-13)21-22(5,6)17(2,3)4/h7-8,11,19H,9-10,12H2,1-6H3/t18-/m1/s1 |
| InChIKey | KODZYCQVFLTTKE-GOSISDBHSA-N |
| XLogP | 3.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|