C18H30O3Si — CID 10980218
1-[1-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-1-hydroxyethyl]cyclopropan-1-ol (PubChem CID 10980218) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is 1-[1-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-1-hydroxyethyl]cyclopropan-1-ol.
| Compound Name | 1-[1-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-1-hydroxyethyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 10980218 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[1-[2-[tert-butyl(dimethyl)silyl]oxy-4-methylphenyl]-1-hydroxyethyl]cyclopropan-1-ol |
| SMILES | Cc1ccc(C(C)(O)C2(O)CC2)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H30O3Si/c1-13-8-9-14(17(5,19)18(20)10-11-18)15(12-13)21-22(6,7)16(2,3)4/h8-9,12,19-20H,10-11H2,1-7H3 |
| InChIKey | KPLWUBIZAYPJSW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|