C38H33NO6 — CID 102457186
2-(4-methoxy-N-(4-methoxyphenyl)anilino)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]fluoren-9-one (PubChem CID 102457186) has the molecular formula C38H33NO6 and a molecular weight of 599.68 g/mol. Its IUPAC name is 2-(4-methoxy-N-(4-methoxyphenyl)anilino)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]fluoren-9-one.
| Compound Name | 2-(4-methoxy-N-(4-methoxyphenyl)anilino)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]fluoren-9-one |
|---|---|
| PubChem CID | 102457186 |
| Molecular Formula | C38H33NO6 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 2-(4-methoxy-N-(4-methoxyphenyl)anilino)-7-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]fluoren-9-one |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)C(=O)c2cc(/C=C/c4cc(OC)c(OC)c(OC)c4)ccc2-3)cc1 |
| InChI | InChI=1S/C38H33NO6/c1-41-29-14-9-26(10-15-29)39(27-11-16-30(42-2)17-12-27)28-13-19-32-31-18-8-24(20-33(31)37(40)34(32)23-28)6-7-25-21-35(43-3)38(45-5)36(22-25)44-4/h6-23H,1-5H3/b7-6+ |
| InChIKey | BLDYIJMTYSPANN-VOTSOKGWSA-N |
| XLogP | 8.58 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|