C26H34N2O2S6 — CID 102458687
S-[6-[2-[5-(6-acetylsulfanylhexyl)-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-[1,3]dithiolo[4,5-c]pyrrol-5-yl]hexyl] ethanethioate (PubChem CID 102458687) has the molecular formula C26H34N2O2S6 and a molecular weight of 598.97 g/mol. Its IUPAC name is S-[6-[2-[5-(6-acetylsulfanylhexyl)-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-[1,3]dithiolo[4,5-c]pyrrol-5-yl]hexyl] ethanethioate.
| Compound Name | S-[6-[2-[5-(6-acetylsulfanylhexyl)-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-[1,3]dithiolo[4,5-c]pyrrol-5-yl]hexyl] ethanethioate |
|---|---|
| PubChem CID | 102458687 |
| Molecular Formula | C26H34N2O2S6 |
| Molecular Weight | 598.97 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | S-[6-[2-[5-(6-acetylsulfanylhexyl)-[1,3]dithiolo[4,5-c]pyrrol-2-ylidene]-[1,3]dithiolo[4,5-c]pyrrol-5-yl]hexyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCn1cc2c(c1)SC(=C1Sc3cn(CCCCCCSC(C)=O)cc3S1)S2 |
| InChI | InChI=1S/C26H34N2O2S6/c1-19(29)31-13-9-5-3-7-11-27-15-21-22(16-27)34-25(33-21)26-35-23-17-28(18-24(23)36-26)12-8-4-6-10-14-32-20(2)30/h15-18H,3-14H2,1-2H3 |
| InChIKey | BZKXBODCHFERJS-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.97 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|