C19H36OSi2 — CID 102464285
[(1S,7aS)-7a-methyl-4-trimethylsilyl-1,2,3,5-tetrahydroinden-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102464285) has the molecular formula C19H36OSi2 and a molecular weight of 336.67 g/mol. Its IUPAC name is [(1S,7aS)-7a-methyl-4-trimethylsilyl-1,2,3,5-tetrahydroinden-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,7aS)-7a-methyl-4-trimethylsilyl-1,2,3,5-tetrahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102464285 |
| Molecular Formula | C19H36OSi2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(1S,7aS)-7a-methyl-4-trimethylsilyl-1,2,3,5-tetrahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC2=C([Si](C)(C)C)CC=C[C@@]21C |
| InChI | InChI=1S/C19H36OSi2/c1-18(2,3)22(8,9)20-17-13-12-15-16(21(5,6)7)11-10-14-19(15,17)4/h10,14,17H,11-13H2,1-9H3/t17-,19-/m0/s1 |
| InChIKey | KNLLKEPZJXNOHO-HKUYNNGSSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|