C20H11NO4S2 — CID 102465887
5-[4-(5-formylthiophen-2-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]thiophene-2-carbaldehyde (PubChem CID 102465887) has the molecular formula C20H11NO4S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 5-[4-(5-formylthiophen-2-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-(5-formylthiophen-2-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 102465887 |
| Molecular Formula | C20H11NO4S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 5-[4-(5-formylthiophen-2-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(C2=C(c3ccc(C=O)s3)C(=O)N(c3ccccc3)C2=O)s1 |
| InChI | InChI=1S/C20H11NO4S2/c22-10-13-6-8-15(26-13)17-18(16-9-7-14(11-23)27-16)20(25)21(19(17)24)12-4-2-1-3-5-12/h1-11H |
| InChIKey | IVGJCNHGGIENEX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|