C26H10F4N2O4 — CID 171592153
2,3,9,10-tetrafluoro-6,13-diphenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 171592153) has the molecular formula C26H10F4N2O4 and a molecular weight of 490.37 g/mol. Its IUPAC name is 2,3,9,10-tetrafluoro-6,13-diphenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,3,9,10-tetrafluoro-6,13-diphenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 171592153 |
| Molecular Formula | C26H10F4N2O4 |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2,3,9,10-tetrafluoro-6,13-diphenyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2c(F)c(F)c3c4c(c(F)c(F)c(c24)C(=O)N1c1ccccc1)C(=O)N(c1ccccc1)C3=O |
| InChI | InChI=1S/C26H10F4N2O4/c27-19-15-13-14-17(21(19)29)25(35)32(12-9-5-2-6-10-12)26(36)18(14)22(30)20(28)16(13)24(34)31(23(15)33)11-7-3-1-4-8-11/h1-10H |
| InChIKey | JNMKBWVFMPJCOA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|