C20H20ClFN6OS — CID 102467411
6-(3-chloro-4-fluoroanilino)-2-(3-morpholin-4-ylpropylamino)-[1,3]thiazolo[4,5-b]pyridine-5-carbonitrile (PubChem CID 102467411) has the molecular formula C20H20ClFN6OS and a molecular weight of 446.94 g/mol. Its IUPAC name is 6-(3-chloro-4-fluoroanilino)-2-(3-morpholin-4-ylpropylamino)-[1,3]thiazolo[4,5-b]pyridine-5-carbonitrile.
| Compound Name | 6-(3-chloro-4-fluoroanilino)-2-(3-morpholin-4-ylpropylamino)-[1,3]thiazolo[4,5-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 102467411 |
| Molecular Formula | C20H20ClFN6OS |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 6-(3-chloro-4-fluoroanilino)-2-(3-morpholin-4-ylpropylamino)-[1,3]thiazolo[4,5-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1nc2nc(NCCCN3CCOCC3)sc2cc1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H20ClFN6OS/c21-14-10-13(2-3-15(14)22)25-16-11-18-19(26-17(16)12-23)27-20(30-18)24-4-1-5-28-6-8-29-9-7-28/h2-3,10-11,25H,1,4-9H2,(H,24,26,27) |
| InChIKey | OGZTZJXQHKSWFN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|