C26H35BO8 — CID 102469492
dimethyl (3R,4E)-3-[(1R)-2-acetyloxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-benzylidenecyclopentane-1,1-dicarboxylate (PubChem CID 102469492) has the molecular formula C26H35BO8 and a molecular weight of 486.37 g/mol. Its IUPAC name is dimethyl (3R,4E)-3-[(1R)-2-acetyloxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-benzylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3R,4E)-3-[(1R)-2-acetyloxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-benzylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102469492 |
| Molecular Formula | C26H35BO8 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | dimethyl (3R,4E)-3-[(1R)-2-acetyloxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-4-benzylidenecyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C(=C\c2ccccc2)[C@@H]([C@H](COC(C)=O)B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C26H35BO8/c1-17(28)33-16-21(27-34-24(2,3)25(4,5)35-27)20-15-26(22(29)31-6,23(30)32-7)14-19(20)13-18-11-9-8-10-12-18/h8-13,20-21H,14-16H2,1-7H3/b19-13+/t20-,21-/m0/s1 |
| InChIKey | XBWRQKFGNALHES-YBUCYZLGSA-N |
| XLogP | 3.84 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|