C13H27IO — CID 102474927
(2R,4R,6R)-2-iodo-6,10-dimethylundecan-4-ol (PubChem CID 102474927) has the molecular formula C13H27IO and a molecular weight of 326.26 g/mol. Its IUPAC name is (2R,4R,6R)-2-iodo-6,10-dimethylundecan-4-ol.
| Compound Name | (2R,4R,6R)-2-iodo-6,10-dimethylundecan-4-ol |
|---|---|
| PubChem CID | 102474927 |
| Molecular Formula | C13H27IO |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (2R,4R,6R)-2-iodo-6,10-dimethylundecan-4-ol |
| SMILES | CC(C)CCC[C@@H](C)C[C@@H](O)C[C@@H](C)I |
| InChI | InChI=1S/C13H27IO/c1-10(2)6-5-7-11(3)8-13(15)9-12(4)14/h10-13,15H,5-9H2,1-4H3/t11-,12-,13-/m1/s1 |
| InChIKey | VXJMUYBUVSKISI-JHJVBQTASA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|