C15H15N3O — CID 102475560
(2R,4S)-4-azido-2-naphthalen-2-yloxane (PubChem CID 102475560) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is (2R,4S)-4-azido-2-naphthalen-2-yloxane.
| Compound Name | (2R,4S)-4-azido-2-naphthalen-2-yloxane |
|---|---|
| PubChem CID | 102475560 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (2R,4S)-4-azido-2-naphthalen-2-yloxane |
| SMILES | [N-]=[N+]=N[C@H]1CCO[C@@H](c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C15H15N3O/c16-18-17-14-7-8-19-15(10-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9,14-15H,7-8,10H2/t14-,15+/m0/s1 |
| InChIKey | CIPACZUKFBFXBO-LSDHHAIUSA-N |
| XLogP | 4.37 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|