C20H23NO4 — CID 102479202
methyl (1S,4Z,5R)-8-benzyl-4-(2-ethoxy-2-oxoethylidene)-8-azabicyclo[3.2.1]oct-6-ene-6-carboxylate (PubChem CID 102479202) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl (1S,4Z,5R)-8-benzyl-4-(2-ethoxy-2-oxoethylidene)-8-azabicyclo[3.2.1]oct-6-ene-6-carboxylate.
| Compound Name | methyl (1S,4Z,5R)-8-benzyl-4-(2-ethoxy-2-oxoethylidene)-8-azabicyclo[3.2.1]oct-6-ene-6-carboxylate |
|---|---|
| PubChem CID | 102479202 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl (1S,4Z,5R)-8-benzyl-4-(2-ethoxy-2-oxoethylidene)-8-azabicyclo[3.2.1]oct-6-ene-6-carboxylate |
| SMILES | CCOC(=O)/C=C1/CC[C@H]2C=C(C(=O)OC)[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO4/c1-3-25-18(22)11-15-9-10-16-12-17(20(23)24-2)19(15)21(16)13-14-7-5-4-6-8-14/h4-8,11-12,16,19H,3,9-10,13H2,1-2H3/b15-11-/t16-,19+/m0/s1 |
| InChIKey | CFAKHHZFSMTDGL-IDSADKGKSA-N |
| XLogP | 2.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|