C23H25NO3S — CID 102481464
(3aR)-8-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-3,3a,6,7-tetrahydro-1H-cyclohepta[c]pyrrole (PubChem CID 102481464) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is (3aR)-8-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-3,3a,6,7-tetrahydro-1H-cyclohepta[c]pyrrole.
| Compound Name | (3aR)-8-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-3,3a,6,7-tetrahydro-1H-cyclohepta[c]pyrrole |
|---|---|
| PubChem CID | 102481464 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (3aR)-8-(4-methoxyphenyl)-2-(4-methylphenyl)sulfonyl-3,3a,6,7-tetrahydro-1H-cyclohepta[c]pyrrole |
| SMILES | COc1ccc(C2=C3CN(S(=O)(=O)c4ccc(C)cc4)C[C@@H]3C=CCC2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c1-17-7-13-21(14-8-17)28(25,26)24-15-19-5-3-4-6-22(23(19)16-24)18-9-11-20(27-2)12-10-18/h3,5,7-14,19H,4,6,15-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | QKXGDNMYKIGAHD-IBGZPJMESA-N |
| XLogP | 4.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|