C23H28NO5P — CID 102484514
(3R,3'R)-1-benzyl-3'-diethoxyphosphoryl-5-propan-2-ylspiro[indole-3,2'-oxirane]-2-one (PubChem CID 102484514) has the molecular formula C23H28NO5P and a molecular weight of 429.45 g/mol. Its IUPAC name is (3R,3'R)-1-benzyl-3'-diethoxyphosphoryl-5-propan-2-ylspiro[indole-3,2'-oxirane]-2-one.
| Compound Name | (3R,3'R)-1-benzyl-3'-diethoxyphosphoryl-5-propan-2-ylspiro[indole-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 102484514 |
| Molecular Formula | C23H28NO5P |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (3R,3'R)-1-benzyl-3'-diethoxyphosphoryl-5-propan-2-ylspiro[indole-3,2'-oxirane]-2-one |
| SMILES | CCOP(=O)(OCC)[C@H]1O[C@]12C(=O)N(Cc1ccccc1)c1ccc(C(C)C)cc12 |
| InChI | InChI=1S/C23H28NO5P/c1-5-27-30(26,28-6-2)22-23(29-22)19-14-18(16(3)4)12-13-20(19)24(21(23)25)15-17-10-8-7-9-11-17/h7-14,16,22H,5-6,15H2,1-4H3/t22-,23-/m1/s1 |
| InChIKey | BBTNJWGENGYQCY-DHIUTWEWSA-N |
| XLogP | 5.17 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|