C20H37ISi — CID 102487025
tert-butyl-[(4S,5E)-2-(iodomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]-dimethylsilane (PubChem CID 102487025) has the molecular formula C20H37ISi and a molecular weight of 432.51 g/mol. Its IUPAC name is tert-butyl-[(4S,5E)-2-(iodomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(4S,5E)-2-(iodomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]-dimethylsilane |
|---|---|
| PubChem CID | 102487025 |
| Molecular Formula | C20H37ISi |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | tert-butyl-[(4S,5E)-2-(iodomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]-dimethylsilane |
| SMILES | C=C(C)CCC/C(C)=C/[C@H](CC(=C)CI)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H37ISi/c1-16(2)11-10-12-17(3)13-19(14-18(4)15-21)22(8,9)20(5,6)7/h13,19H,1,4,10-12,14-15H2,2-3,5-9H3/b17-13+/t19-/m1/s1 |
| InChIKey | SWBSQLOGDUFFTM-XEYRCQSKSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|