C27H31NO5 — CID 102488509
(3aS,4S,7aR)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2S)-2-hydroxy-2-phenylethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 102488509) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (3aS,4S,7aR)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2S)-2-hydroxy-2-phenylethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7aR)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2S)-2-hydroxy-2-phenylethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 102488509 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (3aS,4S,7aR)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(2S)-2-hydroxy-2-phenylethyl]-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1ccc(CCN2C(=O)[C@H]3[C@@H](C[C@H](O)c4ccccc4)C=C(C)C[C@H]3C2=O)cc1OC |
| InChI | InChI=1S/C27H31NO5/c1-17-13-20(16-22(29)19-7-5-4-6-8-19)25-21(14-17)26(30)28(27(25)31)12-11-18-9-10-23(32-2)24(15-18)33-3/h4-10,13,15,20-22,25,29H,11-12,14,16H2,1-3H3/t20-,21-,22+,25+/m1/s1 |
| InChIKey | RRDYNXOTEGSTKC-APDHKMKFSA-N |
| XLogP | 3.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|