C11H15OP — CID 102491201
1,3,4,5-tetramethyl-2-methylidene-6-phosphabicyclo[3.2.0]hept-3-en-7-one (PubChem CID 102491201) has the molecular formula C11H15OP and a molecular weight of 194.21 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-2-methylidene-6-phosphabicyclo[3.2.0]hept-3-en-7-one.
| Compound Name | 1,3,4,5-tetramethyl-2-methylidene-6-phosphabicyclo[3.2.0]hept-3-en-7-one |
|---|---|
| PubChem CID | 102491201 |
| Molecular Formula | C11H15OP |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1,3,4,5-tetramethyl-2-methylidene-6-phosphabicyclo[3.2.0]hept-3-en-7-one |
| SMILES | C=C1C(C)=C(C)C2(C)PC(=O)C12C |
| InChI | InChI=1S/C11H15OP/c1-6-7(2)10(4)9(12)13-11(10,5)8(6)3/h13H,2H2,1,3-5H3 |
| InChIKey | IXQVZQPOWYYITD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|