C33H37NO4Si — CID 102491472
benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-5-(5-oxo-2H-furan-2-yl)pyrrolidine-1-carboxylate (PubChem CID 102491472) has the molecular formula C33H37NO4Si and a molecular weight of 539.75 g/mol. Its IUPAC name is benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-5-(5-oxo-2H-furan-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-5-(5-oxo-2H-furan-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102491472 |
| Molecular Formula | C33H37NO4Si |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]methyl]-5-(5-oxo-2H-furan-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C[C@@H]1CC[C@@H](C2C=CC(=O)O2)N1C(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37NO4Si/c1-33(2,3)39(27-15-9-5-10-16-27,28-17-11-6-12-18-28)24-26-19-20-29(30-21-22-31(35)38-30)34(26)32(36)37-23-25-13-7-4-8-14-25/h4-18,21-22,26,29-30H,19-20,23-24H2,1-3H3/t26-,29-,30?/m0/s1 |
| InChIKey | FYUQCMPIANXVJK-QOXPCENISA-N |
| XLogP | 5.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|