C18H27N3 — CID 102499508
N-[2,6-di(propan-2-yl)phenyl]-1-(3-methyl-2H-imidazol-1-yl)ethanimine (PubChem CID 102499508) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-(3-methyl-2H-imidazol-1-yl)ethanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-(3-methyl-2H-imidazol-1-yl)ethanimine |
|---|---|
| PubChem CID | 102499508 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-(3-methyl-2H-imidazol-1-yl)ethanimine |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)N1C=CN(C)C1 |
| InChI | InChI=1S/C18H27N3/c1-13(2)16-8-7-9-17(14(3)4)18(16)19-15(5)21-11-10-20(6)12-21/h7-11,13-14H,12H2,1-6H3/b19-15+ |
| InChIKey | AMJQDNCVWHRTCC-XDJHFCHBSA-N |
| XLogP | 4.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|