C11H15NO3S — CID 102500912
2-[(2S)-4,4-bis(hydroxymethyl)-1,3-thiazolidin-2-yl]phenol (PubChem CID 102500912) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-[(2S)-4,4-bis(hydroxymethyl)-1,3-thiazolidin-2-yl]phenol.
| Compound Name | 2-[(2S)-4,4-bis(hydroxymethyl)-1,3-thiazolidin-2-yl]phenol |
|---|---|
| PubChem CID | 102500912 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-[(2S)-4,4-bis(hydroxymethyl)-1,3-thiazolidin-2-yl]phenol |
| SMILES | OCC1(CO)CS[C@@H](c2ccccc2O)N1 |
| InChI | InChI=1S/C11H15NO3S/c13-5-11(6-14)7-16-10(12-11)8-3-1-2-4-9(8)15/h1-4,10,12-15H,5-7H2/t10-/m0/s1 |
| InChIKey | HIJPYZWIAAKFSX-JTQLQIEISA-N |
| XLogP | 0.45 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|