About diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane
diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane (PubChem CID 102512205) has the molecular formula C26H30NP
and a molecular weight of 387.51 g/mol. Its IUPAC name is diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane.
Molecular Properties
| Compound Name | diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane |
| PubChem CID | 102512205 |
| Molecular Formula | C26H30NP |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane |
| SMILES | CC(C)c1cccc([C@@H]2CCCC[C@H]2P(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C26H30NP/c1-20(2)24-17-11-18-25(27-24)23-16-9-10-19-26(23)28(21-12-5-3-6-13-21)22-14-7-4-8-15-22/h3-8,11-15,17-18,20,23,26H,9-10,16,19H2,1-2H3/t23-,26+/m0/s1 |
| InChIKey | SCOCUQNUKUSKHT-JYFHCDHNSA-N |
| XLogP | 6.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane?
The IUPAC name of diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane (CID 102512205) is diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane.
What is the SMILES notation for diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane?
The canonical SMILES for diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane is CC(C)c1cccc([C@@H]2CCCC[C@H]2P(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane?
The InChIKey is SCOCUQNUKUSKHT-JYFHCDHNSA-N. The full InChI is InChI=1S/C26H30NP/c1-20(2)24-17-11-18-25(27-24)23-16-9-10-19-26(23)28(21-12-5-3-6-13-21)22-14-7-4-8-15-22/h3-8,11-15,17-18,20,23,26H,9-10,16,19H2,1-2H3/t23-,26+/m0/s1.
What are the key properties of diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane?
diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane has a molecular weight of 387.51 g/mol, XLogP of 6.36, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[(1R,2S)-2-(6-propan-2-yl-2-pyridinyl)cyclohexyl]phosphane is sourced from PubChem (CID 102512205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).