C31H20Br2O2 — CID 102522852
2,7-dibromo-9,9-bis(4-prop-2-ynoxyphenyl)fluorene (PubChem CID 102522852) has the molecular formula C31H20Br2O2 and a molecular weight of 584.31 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis(4-prop-2-ynoxyphenyl)fluorene.
| Compound Name | 2,7-dibromo-9,9-bis(4-prop-2-ynoxyphenyl)fluorene |
|---|---|
| PubChem CID | 102522852 |
| Molecular Formula | C31H20Br2O2 |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 581.98 |
| IUPAC Name | 2,7-dibromo-9,9-bis(4-prop-2-ynoxyphenyl)fluorene |
| SMILES | C#CCOc1ccc(C2(c3ccc(OCC#C)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C31H20Br2O2/c1-3-17-34-25-11-5-21(6-12-25)31(22-7-13-26(14-8-22)35-18-4-2)29-19-23(32)9-15-27(29)28-16-10-24(33)20-30(28)31/h1-2,5-16,19-20H,17-18H2 |
| InChIKey | ZIDMWCAUMKUKBO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|