C31H18Br2N6S4 — CID 71217277
6-[4-[9-[4-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]phenyl]-2,7-dibromofluoren-9-yl]phenyl]-1H-1,3,5-triazine-2,4-dithione (PubChem CID 71217277) has the molecular formula C31H18Br2N6S4 and a molecular weight of 762.60 g/mol. Its IUPAC name is 6-[4-[9-[4-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]phenyl]-2,7-dibromofluoren-9-yl]phenyl]-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-[4-[9-[4-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]phenyl]-2,7-dibromofluoren-9-yl]phenyl]-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 71217277 |
| Molecular Formula | C31H18Br2N6S4 |
| Molecular Weight | 762.60 g/mol |
| Exact Mass | 759.88 |
| IUPAC Name | 6-[4-[9-[4-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]phenyl]-2,7-dibromofluoren-9-yl]phenyl]-1H-1,3,5-triazine-2,4-dithione |
| SMILES | S=c1nc(-c2ccc(C3(c4ccc(-c5nc(=S)[nH]c(=S)[nH]5)cc4)c4cc(Br)ccc4-c4ccc(Br)cc43)cc2)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C31H18Br2N6S4/c32-19-9-11-21-22-12-10-20(33)14-24(22)31(23(21)13-19,17-5-1-15(2-6-17)25-34-27(40)38-28(41)35-25)18-7-3-16(4-8-18)26-36-29(42)39-30(43)37-26/h1-14H,(H2,34,35,38,40,41)(H2,36,37,39,42,43) |
| InChIKey | AOADXWCYBKMHFF-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.60 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|