C21H36O2SSi — CID 102523446
(1R,2S)-2-methylsulfanyl-1-phenyl-3-[tri(propan-2-yl)silyloxymethyl]but-3-en-1-ol (PubChem CID 102523446) has the molecular formula C21H36O2SSi and a molecular weight of 380.67 g/mol. Its IUPAC name is (1R,2S)-2-methylsulfanyl-1-phenyl-3-[tri(propan-2-yl)silyloxymethyl]but-3-en-1-ol.
| Compound Name | (1R,2S)-2-methylsulfanyl-1-phenyl-3-[tri(propan-2-yl)silyloxymethyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 102523446 |
| Molecular Formula | C21H36O2SSi |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (1R,2S)-2-methylsulfanyl-1-phenyl-3-[tri(propan-2-yl)silyloxymethyl]but-3-en-1-ol |
| SMILES | C=C(CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](SC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H36O2SSi/c1-15(2)25(16(3)4,17(5)6)23-14-18(7)21(24-8)20(22)19-12-10-9-11-13-19/h9-13,15-17,20-22H,7,14H2,1-6,8H3/t20-,21+/m1/s1 |
| InChIKey | MSXPCXSQRGVXOU-RTWAWAEBSA-N |
| XLogP | 6.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|