C11H9F4NO — CID 102529577
2-(4,5,6,7-tetrafluoro-1H-indol-2-yl)propan-2-ol (PubChem CID 102529577) has the molecular formula C11H9F4NO and a molecular weight of 247.19 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrafluoro-1H-indol-2-yl)propan-2-ol.
| Compound Name | 2-(4,5,6,7-tetrafluoro-1H-indol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 102529577 |
| Molecular Formula | C11H9F4NO |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-(4,5,6,7-tetrafluoro-1H-indol-2-yl)propan-2-ol |
| SMILES | CC(C)(O)c1cc2c(F)c(F)c(F)c(F)c2[nH]1 |
| InChI | InChI=1S/C11H9F4NO/c1-11(2,17)5-3-4-6(12)7(13)8(14)9(15)10(4)16-5/h3,16-17H,1-2H3 |
| InChIKey | XVNXDNBIFFISPR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|