C11H15FN5O8P2- — CID 102531950
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-fluoro-dioxidophosphanium (PubChem CID 102531950) has the molecular formula C11H15FN5O8P2- and a molecular weight of 426.21 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-fluoro-dioxidophosphanium.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-fluoro-dioxidophosphanium |
|---|---|
| PubChem CID | 102531950 |
| Molecular Formula | C11H15FN5O8P2- |
| Molecular Weight | 426.21 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methyl-fluoro-dioxidophosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)C[P+]([O-])([O-])F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H16FN5O8P2/c12-26(20,21)4-27(22,23)24-1-5-7(18)8(19)11(25-5)17-3-16-6-9(13)14-2-15-10(6)17/h2-3,5,7-8,11,18-19H,1,4H2,(H,20,21)(H,22,23)(H2,13,14,15)/p-1/t5-,7-,8-,11-/m1/s1 |
| InChIKey | BMZHWKZDHHVTRW-IOSLPCCCSA-M |
| XLogP | -2.36 |
| TPSA | 211.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.21 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|